C15H23NO5S — CID 123123498
propyl 2-[(4-oxo-5-propoxy-1H-pyridin-2-yl)methylsulfinyl]propanoate (PubChem CID 123123498) has the molecular formula C15H23NO5S and a molecular weight of 329.42 g/mol. Its IUPAC name is propyl 2-[(4-oxo-5-propoxy-1H-pyridin-2-yl)methylsulfinyl]propanoate.
| Compound Name | propyl 2-[(4-oxo-5-propoxy-1H-pyridin-2-yl)methylsulfinyl]propanoate |
|---|---|
| PubChem CID | 123123498 |
| Molecular Formula | C15H23NO5S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | propyl 2-[(4-oxo-5-propoxy-1H-pyridin-2-yl)methylsulfinyl]propanoate |
| SMILES | CCCOC(=O)C(C)S(=O)Cc1cc(=O)c(OCCC)c[nH]1 |
| InChI | InChI=1S/C15H23NO5S/c1-4-6-20-14-9-16-12(8-13(14)17)10-22(19)11(3)15(18)21-7-5-2/h8-9,11H,4-7,10H2,1-3H3,(H,16,17) |
| InChIKey | GBXKECRENGCVOZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |