C13H20N2O4S — CID 123123608
4-[(4-oxo-5-propoxy-1H-pyridin-2-yl)methylsulfinyl]butanamide (PubChem CID 123123608) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 4-[(4-oxo-5-propoxy-1H-pyridin-2-yl)methylsulfinyl]butanamide.
| Compound Name | 4-[(4-oxo-5-propoxy-1H-pyridin-2-yl)methylsulfinyl]butanamide |
|---|---|
| PubChem CID | 123123608 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 4-[(4-oxo-5-propoxy-1H-pyridin-2-yl)methylsulfinyl]butanamide |
| SMILES | CCCOc1c[nH]c(CS(=O)CCCC(N)=O)cc1=O |
| InChI | InChI=1S/C13H20N2O4S/c1-2-5-19-12-8-15-10(7-11(12)16)9-20(18)6-3-4-13(14)17/h7-8H,2-6,9H2,1H3,(H2,14,17)(H,15,16) |
| InChIKey | SNQOJCXMRYJTCR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |