C18H22ClNO4S — CID 123116864
2-[3-(4-chlorophenoxy)propylsulfinylmethyl]-5-propoxy-1H-pyridin-4-one (PubChem CID 123116864) has the molecular formula C18H22ClNO4S and a molecular weight of 383.90 g/mol. Its IUPAC name is 2-[3-(4-chlorophenoxy)propylsulfinylmethyl]-5-propoxy-1H-pyridin-4-one.
| Compound Name | 2-[3-(4-chlorophenoxy)propylsulfinylmethyl]-5-propoxy-1H-pyridin-4-one |
|---|---|
| PubChem CID | 123116864 |
| Molecular Formula | C18H22ClNO4S |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 2-[3-(4-chlorophenoxy)propylsulfinylmethyl]-5-propoxy-1H-pyridin-4-one |
| SMILES | CCCOc1c[nH]c(CS(=O)CCCOc2ccc(Cl)cc2)cc1=O |
| InChI | InChI=1S/C18H22ClNO4S/c1-2-8-24-18-12-20-15(11-17(18)21)13-25(22)10-3-9-23-16-6-4-14(19)5-7-16/h4-7,11-12H,2-3,8-10,13H2,1H3,(H,20,21) |
| InChIKey | PZPOKVPTLBFNCV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|