C9H12N4O2 — CID 42625825
2-(azidomethyl)-5-propoxy-1H-pyridin-4-one (PubChem CID 42625825) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-(azidomethyl)-5-propoxy-1H-pyridin-4-one.
| Compound Name | 2-(azidomethyl)-5-propoxy-1H-pyridin-4-one |
|---|---|
| PubChem CID | 42625825 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-(azidomethyl)-5-propoxy-1H-pyridin-4-one |
| SMILES | CCCOc1c[nH]c(CN=[N+]=[N-])cc1=O |
| InChI | InChI=1S/C9H12N4O2/c1-2-3-15-9-6-11-7(4-8(9)14)5-12-13-10/h4,6H,2-3,5H2,1H3,(H,11,14) |
| InChIKey | QASGOFYGOPGLTE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 90.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|