C11H16ClNO2 — CID 82063817
2-(chloromethyl)-5-pentoxy-1H-pyridin-4-one (PubChem CID 82063817) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 2-(chloromethyl)-5-pentoxy-1H-pyridin-4-one.
| Compound Name | 2-(chloromethyl)-5-pentoxy-1H-pyridin-4-one |
|---|---|
| PubChem CID | 82063817 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-(chloromethyl)-5-pentoxy-1H-pyridin-4-one |
| SMILES | CCCCCOc1c[nH]c(CCl)cc1=O |
| InChI | InChI=1S/C11H16ClNO2/c1-2-3-4-5-15-11-8-13-9(7-12)6-10(11)14/h6,8H,2-5,7H2,1H3,(H,13,14) |
| InChIKey | QDDRYKABUYPSKW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|