C16H25NO5S — CID 123123491
butyl 2-[(4-oxo-5-propoxy-1H-pyridin-2-yl)methylsulfinyl]propanoate (PubChem CID 123123491) has the molecular formula C16H25NO5S and a molecular weight of 343.45 g/mol. Its IUPAC name is butyl 2-[(4-oxo-5-propoxy-1H-pyridin-2-yl)methylsulfinyl]propanoate.
| Compound Name | butyl 2-[(4-oxo-5-propoxy-1H-pyridin-2-yl)methylsulfinyl]propanoate |
|---|---|
| PubChem CID | 123123491 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | butyl 2-[(4-oxo-5-propoxy-1H-pyridin-2-yl)methylsulfinyl]propanoate |
| SMILES | CCCCOC(=O)C(C)S(=O)Cc1cc(=O)c(OCCC)c[nH]1 |
| InChI | InChI=1S/C16H25NO5S/c1-4-6-8-22-16(19)12(3)23(20)11-13-9-14(18)15(10-17-13)21-7-5-2/h9-10,12H,4-8,11H2,1-3H3,(H,17,18) |
| InChIKey | GGQBUDQZDDRXEU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|