C9H13NO4 — CID 82063902
2-(hydroxymethyl)-5-(3-hydroxypropoxy)-1H-pyridin-4-one (PubChem CID 82063902) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-(hydroxymethyl)-5-(3-hydroxypropoxy)-1H-pyridin-4-one.
| Compound Name | 2-(hydroxymethyl)-5-(3-hydroxypropoxy)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 82063902 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-(hydroxymethyl)-5-(3-hydroxypropoxy)-1H-pyridin-4-one |
| SMILES | O=c1cc(CO)[nH]cc1OCCCO |
| InChI | InChI=1S/C9H13NO4/c11-2-1-3-14-9-5-10-7(6-12)4-8(9)13/h4-5,11-12H,1-3,6H2,(H,10,13) |
| InChIKey | CWJYXPAKFYEYNK-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|