C6H6FNO2 — CID 130781626
5-fluoro-2-(hydroxymethyl)-1H-pyridin-4-one (PubChem CID 130781626) has the molecular formula C6H6FNO2 and a molecular weight of 143.12 g/mol. Its IUPAC name is 5-fluoro-2-(hydroxymethyl)-1H-pyridin-4-one.
| Compound Name | 5-fluoro-2-(hydroxymethyl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 130781626 |
| Molecular Formula | C6H6FNO2 |
| Molecular Weight | 143.12 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | 5-fluoro-2-(hydroxymethyl)-1H-pyridin-4-one |
| SMILES | O=c1cc(CO)[nH]cc1F |
| InChI | InChI=1S/C6H6FNO2/c7-5-2-8-4(3-9)1-6(5)10/h1-2,9H,3H2,(H,8,10) |
| InChIKey | MOGXPYAUFFALTQ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.12 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |