C7H6F3NO2 — CID 130079591
3-(difluoromethyl)-5-fluoro-4-(hydroxymethyl)-1H-pyridin-2-one (PubChem CID 130079591) has the molecular formula C7H6F3NO2 and a molecular weight of 193.12 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-fluoro-4-(hydroxymethyl)-1H-pyridin-2-one.
| Compound Name | 3-(difluoromethyl)-5-fluoro-4-(hydroxymethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130079591 |
| Molecular Formula | C7H6F3NO2 |
| Molecular Weight | 193.12 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 3-(difluoromethyl)-5-fluoro-4-(hydroxymethyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(F)c(CO)c1C(F)F |
| InChI | InChI=1S/C7H6F3NO2/c8-4-1-11-7(13)5(6(9)10)3(4)2-12/h1,6,12H,2H2,(H,11,13) |
| InChIKey | RTUULSBKXZVMLC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.12 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |