C8H8F2N2O2 — CID 130084648
4-(aminomethyl)-5-(difluoromethyl)-6-oxo-1H-pyridine-3-carbaldehyde (PubChem CID 130084648) has the molecular formula C8H8F2N2O2 and a molecular weight of 202.16 g/mol. Its IUPAC name is 4-(aminomethyl)-5-(difluoromethyl)-6-oxo-1H-pyridine-3-carbaldehyde.
| Compound Name | 4-(aminomethyl)-5-(difluoromethyl)-6-oxo-1H-pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 130084648 |
| Molecular Formula | C8H8F2N2O2 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 4-(aminomethyl)-5-(difluoromethyl)-6-oxo-1H-pyridine-3-carbaldehyde |
| SMILES | NCc1c(C=O)c[nH]c(=O)c1C(F)F |
| InChI | InChI=1S/C8H8F2N2O2/c9-7(10)6-5(1-11)4(3-13)2-12-8(6)14/h2-3,7H,1,11H2,(H,12,14) |
| InChIKey | ZQEBXUPFGMQCJA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|