C8H9F2NO3 — CID 130083415
3-(difluoromethyl)-4-(hydroxymethyl)-5-methoxy-1H-pyridin-2-one (PubChem CID 130083415) has the molecular formula C8H9F2NO3 and a molecular weight of 205.16 g/mol. Its IUPAC name is 3-(difluoromethyl)-4-(hydroxymethyl)-5-methoxy-1H-pyridin-2-one.
| Compound Name | 3-(difluoromethyl)-4-(hydroxymethyl)-5-methoxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130083415 |
| Molecular Formula | C8H9F2NO3 |
| Molecular Weight | 205.16 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 3-(difluoromethyl)-4-(hydroxymethyl)-5-methoxy-1H-pyridin-2-one |
| SMILES | COc1c[nH]c(=O)c(C(F)F)c1CO |
| InChI | InChI=1S/C8H9F2NO3/c1-14-5-2-11-8(13)6(7(9)10)4(5)3-12/h2,7,12H,3H2,1H3,(H,11,13) |
| InChIKey | SDWTWCSLJFKABI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.16 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |