C10H11F2NO4 — CID 133103145
methyl 2-[3-(difluoromethyl)-5-methoxy-4-oxo-1H-pyridin-2-yl]acetate (PubChem CID 133103145) has the molecular formula C10H11F2NO4 and a molecular weight of 247.20 g/mol. Its IUPAC name is methyl 2-[3-(difluoromethyl)-5-methoxy-4-oxo-1H-pyridin-2-yl]acetate.
| Compound Name | methyl 2-[3-(difluoromethyl)-5-methoxy-4-oxo-1H-pyridin-2-yl]acetate |
|---|---|
| PubChem CID | 133103145 |
| Molecular Formula | C10H11F2NO4 |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | methyl 2-[3-(difluoromethyl)-5-methoxy-4-oxo-1H-pyridin-2-yl]acetate |
| SMILES | COC(=O)Cc1[nH]cc(OC)c(=O)c1C(F)F |
| InChI | InChI=1S/C10H11F2NO4/c1-16-6-4-13-5(3-7(14)17-2)8(9(6)15)10(11)12/h4,10H,3H2,1-2H3,(H,13,15) |
| InChIKey | DOSCPRIAHSEUCH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |