C6H6ClNO2 — CID 130893492
5-chloro-2-(hydroxymethyl)-1H-pyridin-4-one (PubChem CID 130893492) has the molecular formula C6H6ClNO2 and a molecular weight of 159.57 g/mol. Its IUPAC name is 5-chloro-2-(hydroxymethyl)-1H-pyridin-4-one.
| Compound Name | 5-chloro-2-(hydroxymethyl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 130893492 |
| Molecular Formula | C6H6ClNO2 |
| Molecular Weight | 159.57 g/mol |
| Exact Mass | 159.01 |
| IUPAC Name | 5-chloro-2-(hydroxymethyl)-1H-pyridin-4-one |
| SMILES | O=c1cc(CO)[nH]cc1Cl |
| InChI | InChI=1S/C6H6ClNO2/c7-5-2-8-4(3-9)1-6(5)10/h1-2,9H,3H2,(H,8,10) |
| InChIKey | UXHXRKRGAODCMU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.57 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |