C12H10ClN3O3 — CID 135818561
2-[(4-chlorophenyl)diazenyl]-3-hydroxy-6-(hydroxymethyl)-1H-pyridin-4-one (PubChem CID 135818561) has the molecular formula C12H10ClN3O3 and a molecular weight of 279.68 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)diazenyl]-3-hydroxy-6-(hydroxymethyl)-1H-pyridin-4-one.
| Compound Name | 2-[(4-chlorophenyl)diazenyl]-3-hydroxy-6-(hydroxymethyl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 135818561 |
| Molecular Formula | C12H10ClN3O3 |
| Molecular Weight | 279.68 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 2-[(4-chlorophenyl)diazenyl]-3-hydroxy-6-(hydroxymethyl)-1H-pyridin-4-one |
| SMILES | O=c1cc(CO)[nH]c(/N=N/c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C12H10ClN3O3/c13-7-1-3-8(4-2-7)15-16-12-11(19)10(18)5-9(6-17)14-12/h1-5,17,19H,6H2,(H,14,18)/b16-15+ |
| InChIKey | ZBRQPGSVRHNWNL-FOCLMDBBSA-N |
| XLogP | 2.64 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.68 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|