C36H38Cl2N4O4 — CID 123133599
bis[3-(4-chlorophenyl)-1-(dimethylamino)-3-pyridin-2-ylpropyl] (Z)-but-2-enedioate (PubChem CID 123133599) has the molecular formula C36H38Cl2N4O4 and a molecular weight of 661.63 g/mol. Its IUPAC name is bis[3-(4-chlorophenyl)-1-(dimethylamino)-3-pyridin-2-ylpropyl] (Z)-but-2-enedioate.
| Compound Name | bis[3-(4-chlorophenyl)-1-(dimethylamino)-3-pyridin-2-ylpropyl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 123133599 |
| Molecular Formula | C36H38Cl2N4O4 |
| Molecular Weight | 661.63 g/mol |
| Exact Mass | 660.23 |
| IUPAC Name | bis[3-(4-chlorophenyl)-1-(dimethylamino)-3-pyridin-2-ylpropyl] (Z)-but-2-enedioate |
| SMILES | CN(C)C(CC(c1ccc(Cl)cc1)c1ccccn1)OC(=O)/C=C\C(=O)OC(CC(c1ccc(Cl)cc1)c1ccccn1)N(C)C |
| InChI | InChI=1S/C36H38Cl2N4O4/c1-41(2)33(23-29(31-9-5-7-21-39-31)25-11-15-27(37)16-12-25)45-35(43)19-20-36(44)46-34(42(3)4)24-30(32-10-6-8-22-40-32)26-13-17-28(38)18-14-26/h5-22,29-30,33-34H,23-24H2,1-4H3/b20-19- |
| InChIKey | GGECVMBKIDWDRK-VXPUYCOJSA-N |
| XLogP | 6.95 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.63 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|