C6H9NO2S — CID 123136344
4-hydroxy-3-propyl-1,3-thiazol-2-one (PubChem CID 123136344) has the molecular formula C6H9NO2S and a molecular weight of 159.21 g/mol. Its IUPAC name is 4-hydroxy-3-propyl-1,3-thiazol-2-one.
| Compound Name | 4-hydroxy-3-propyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 123136344 |
| Molecular Formula | C6H9NO2S |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 4-hydroxy-3-propyl-1,3-thiazol-2-one |
| SMILES | CCCn1c(O)csc1=O |
| InChI | InChI=1S/C6H9NO2S/c1-2-3-7-5(8)4-10-6(7)9/h4,8H,2-3H2,1H3 |
| InChIKey | LMJADCIRDXECPN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |