C5H7NO2S — CID 54276559
3-ethyl-4-hydroxy-1,3-thiazol-2-one (PubChem CID 54276559) has the molecular formula C5H7NO2S and a molecular weight of 145.18 g/mol. Its IUPAC name is 3-ethyl-4-hydroxy-1,3-thiazol-2-one.
| Compound Name | 3-ethyl-4-hydroxy-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 54276559 |
| Molecular Formula | C5H7NO2S |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | 3-ethyl-4-hydroxy-1,3-thiazol-2-one |
| SMILES | CCn1c(O)csc1=O |
| InChI | InChI=1S/C5H7NO2S/c1-2-6-4(7)3-9-5(6)8/h3,7H,2H2,1H3 |
| InChIKey | RNUUZHJIVNBBCW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |