About 3-methyl-2-oxo-1,3-thiazol-4-olate
3-methyl-2-oxo-1,3-thiazol-4-olate (PubChem CID 59024639) has the molecular formula C4H4NO2S-
and a molecular weight of 130.15 g/mol. Its IUPAC name is 3-methyl-2-oxo-1,3-thiazol-4-olate.
Molecular Properties
| Compound Name | 3-methyl-2-oxo-1,3-thiazol-4-olate |
| PubChem CID | 59024639 |
| Molecular Formula | C4H4NO2S- |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.00 |
| IUPAC Name | 3-methyl-2-oxo-1,3-thiazol-4-olate |
| SMILES | Cn1c([O-])csc1=O |
| InChI | InChI=1S/C4H5NO2S/c1-5-3(6)2-8-4(5)7/h2,6H,1H3/p-1 |
| InChIKey | ZTOPLIIHRUHGMG-UHFFFAOYSA-M |
| XLogP | -0.48 |
| TPSA | 45.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-2-oxo-1,3-thiazol-4-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-oxo-1,3-thiazol-4-olate?
The IUPAC name of 3-methyl-2-oxo-1,3-thiazol-4-olate (CID 59024639) is 3-methyl-2-oxo-1,3-thiazol-4-olate.
What is the SMILES notation for 3-methyl-2-oxo-1,3-thiazol-4-olate?
The canonical SMILES for 3-methyl-2-oxo-1,3-thiazol-4-olate is Cn1c([O-])csc1=O.
What is the InChIKey of 3-methyl-2-oxo-1,3-thiazol-4-olate?
The InChIKey is ZTOPLIIHRUHGMG-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H5NO2S/c1-5-3(6)2-8-4(5)7/h2,6H,1H3/p-1.
What are the key properties of 3-methyl-2-oxo-1,3-thiazol-4-olate?
3-methyl-2-oxo-1,3-thiazol-4-olate has a molecular weight of 130.15 g/mol, XLogP of -0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-oxo-1,3-thiazol-4-olate is sourced from PubChem (CID 59024639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).