C46H38N4O2+2 — CID 123137670
2-ethyl-5-[7-(1-ethyl-8-methoxyquinolin-1-ium-7-yl)-4-pyrimidin-5-yl-1,12b-dihydrobenzo[a]anthracen-12-yl]-3-oxa-1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene (PubChem CID 123137670) has the molecular formula C46H38N4O2+2 and a molecular weight of 678.84 g/mol. Its IUPAC name is 2-ethyl-5-[7-(1-ethyl-8-methoxyquinolin-1-ium-7-yl)-4-pyrimidin-5-yl-1,12b-dihydrobenzo[a]anthracen-12-yl]-3-oxa-1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene.
| Compound Name | 2-ethyl-5-[7-(1-ethyl-8-methoxyquinolin-1-ium-7-yl)-4-pyrimidin-5-yl-1,12b-dihydrobenzo[a]anthracen-12-yl]-3-oxa-1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
|---|---|
| PubChem CID | 123137670 |
| Molecular Formula | C46H38N4O2+2 |
| Molecular Weight | 678.84 g/mol |
| Exact Mass | 678.30 |
| IUPAC Name | 2-ethyl-5-[7-(1-ethyl-8-methoxyquinolin-1-ium-7-yl)-4-pyrimidin-5-yl-1,12b-dihydrobenzo[a]anthracen-12-yl]-3-oxa-1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
| SMILES | CCC1Oc2c(-c3c4c(c(-c5ccc6ccc[n+](CC)c6c5OC)c5ccccc35)C=CC3=C(c5cncnc5)C=CCC34)ccc3ccc[n+]1c23 |
| InChI | InChI=1S/C46H38N4O2/c1-4-39-50-24-10-12-29-18-20-38(46(52-39)44(29)50)42-35-14-7-6-13-34(35)40(37-19-17-28-11-9-23-49(5-2)43(28)45(37)51-3)36-22-21-32-31(30-25-47-27-48-26-30)15-8-16-33(32)41(36)42/h6-15,17-27,33,39H,4-5,16H2,1-3H3/q+2 |
| InChIKey | RRGYPRBVONBOLP-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.84 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|