C28H29FN2O6 — CID 123138681
1-[4-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]piperidin-1-yl]-2-pyridin-3-ylethanone;oxalic acid (PubChem CID 123138681) has the molecular formula C28H29FN2O6 and a molecular weight of 508.55 g/mol. Its IUPAC name is 1-[4-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]piperidin-1-yl]-2-pyridin-3-ylethanone;oxalic acid.
| Compound Name | 1-[4-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]piperidin-1-yl]-2-pyridin-3-ylethanone;oxalic acid |
|---|---|
| PubChem CID | 123138681 |
| Molecular Formula | C28H29FN2O6 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 1-[4-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]piperidin-1-yl]-2-pyridin-3-ylethanone;oxalic acid |
| SMILES | O=C(Cc1cccnc1)N1CCC(Cc2ccc(OCc3cccc(F)c3)cc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H27FN2O2.C2H2O4/c27-24-5-1-3-23(16-24)19-31-25-8-6-20(7-9-25)15-21-10-13-29(14-11-21)26(30)17-22-4-2-12-28-18-22;3-1(4)2(5)6/h1-9,12,16,18,21H,10-11,13-15,17,19H2;(H,3,4)(H,5,6) |
| InChIKey | XXEREDBZZQDFGT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|