C14H15BrN4O — CID 123138831
N-(5-bromo-2-pyridinyl)-6-morpholin-2-ylpyridin-3-amine (PubChem CID 123138831) has the molecular formula C14H15BrN4O and a molecular weight of 335.21 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-6-morpholin-2-ylpyridin-3-amine.
| Compound Name | N-(5-bromo-2-pyridinyl)-6-morpholin-2-ylpyridin-3-amine |
|---|---|
| PubChem CID | 123138831 |
| Molecular Formula | C14H15BrN4O |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-6-morpholin-2-ylpyridin-3-amine |
| SMILES | Brc1ccc(Nc2ccc(C3CNCCO3)nc2)nc1 |
| InChI | InChI=1S/C14H15BrN4O/c15-10-1-4-14(18-7-10)19-11-2-3-12(17-8-11)13-9-16-5-6-20-13/h1-4,7-8,13,16H,5-6,9H2,(H,18,19) |
| InChIKey | PNLLNPQSZMJRQJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |