C17H23NO5 — CID 123139703
2-[[(1S,7R)-3,5,10-trihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl]methyl]cyclohexane-1-carboxylic acid (PubChem CID 123139703) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-[[(1S,7R)-3,5,10-trihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[[(1S,7R)-3,5,10-trihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 123139703 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-[[(1S,7R)-3,5,10-trihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5-dien-4-yl]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCCC1Cn1c(O)c2c(c1O)[C@@H]1CC[C@H]2C1O |
| InChI | InChI=1S/C17H23NO5/c19-14-10-5-6-11(14)13-12(10)15(20)18(16(13)21)7-8-3-1-2-4-9(8)17(22)23/h8-11,14,19-21H,1-7H2,(H,22,23)/t8?,9?,10-,11+,14? |
| InChIKey | UOPUADYVUMIXCS-UETZGGLUSA-N |
| XLogP | 2.13 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |