C23H35NO5 — CID 90834173
1-butoxyethyl 6-(3,5-dihydroxy-11-methyl-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-dien-4-yl)hexanoate (PubChem CID 90834173) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-butoxyethyl 6-(3,5-dihydroxy-11-methyl-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-dien-4-yl)hexanoate.
| Compound Name | 1-butoxyethyl 6-(3,5-dihydroxy-11-methyl-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-dien-4-yl)hexanoate |
|---|---|
| PubChem CID | 90834173 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 1-butoxyethyl 6-(3,5-dihydroxy-11-methyl-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-dien-4-yl)hexanoate |
| SMILES | CCCCOC(C)OC(=O)CCCCCn1c(O)c2c(c1O)C1C(C)C2C2CC21 |
| InChI | InChI=1S/C23H35NO5/c1-4-5-11-28-14(3)29-17(25)9-7-6-8-10-24-22(26)20-18-13(2)19(16-12-15(16)18)21(20)23(24)27/h13-16,18-19,26-27H,4-12H2,1-3H3 |
| InChIKey | DRDCQAXXPGGSBR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|