C41H58N2O10 — CID 91447607
1-[4-[1-[6-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoyloxy]ethoxy]butoxy]ethyl 6-[3-cyclobut-2-en-1-yl-2,5-dihydroxy-4-(2-methylcyclopropyl)pyrrol-1-yl]hexanoate (PubChem CID 91447607) has the molecular formula C41H58N2O10 and a molecular weight of 738.92 g/mol. Its IUPAC name is 1-[4-[1-[6-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoyloxy]ethoxy]butoxy]ethyl 6-[3-cyclobut-2-en-1-yl-2,5-dihydroxy-4-(2-methylcyclopropyl)pyrrol-1-yl]hexanoate.
| Compound Name | 1-[4-[1-[6-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoyloxy]ethoxy]butoxy]ethyl 6-[3-cyclobut-2-en-1-yl-2,5-dihydroxy-4-(2-methylcyclopropyl)pyrrol-1-yl]hexanoate |
|---|---|
| PubChem CID | 91447607 |
| Molecular Formula | C41H58N2O10 |
| Molecular Weight | 738.92 g/mol |
| Exact Mass | 738.41 |
| IUPAC Name | 1-[4-[1-[6-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoyloxy]ethoxy]butoxy]ethyl 6-[3-cyclobut-2-en-1-yl-2,5-dihydroxy-4-(2-methylcyclopropyl)pyrrol-1-yl]hexanoate |
| SMILES | CC(OCCCCOC(C)OC(=O)CCCCCn1c(O)c(C2C=CC2)c(C2CC2C)c1O)OC(=O)CCCCCn1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C41H58N2O10/c1-25-23-31(25)37-34(28-13-12-14-28)38(46)43(41(37)49)20-9-5-7-16-33(45)53-27(3)51-22-11-10-21-50-26(2)52-32(44)15-6-4-8-19-42-39(47)35-29-17-18-30(24-29)36(35)40(42)48/h12-13,17-18,25-31,46-49H,4-11,14-16,19-24H2,1-3H3 |
| InChIKey | IBQULTJTRAWTQO-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.92 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|