C40H56N2O9 — CID 91293439
1-[4-[1-[6-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoyloxy]ethoxy]butoxy]ethyl 6-(3-methylidene-7-oxo-4-azatricyclo[6.2.1.02,6]undec-8-en-4-yl)hexanoate (PubChem CID 91293439) has the molecular formula C40H56N2O9 and a molecular weight of 708.89 g/mol. Its IUPAC name is 1-[4-[1-[6-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoyloxy]ethoxy]butoxy]ethyl 6-(3-methylidene-7-oxo-4-azatricyclo[6.2.1.02,6]undec-8-en-4-yl)hexanoate.
| Compound Name | 1-[4-[1-[6-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoyloxy]ethoxy]butoxy]ethyl 6-(3-methylidene-7-oxo-4-azatricyclo[6.2.1.02,6]undec-8-en-4-yl)hexanoate |
|---|---|
| PubChem CID | 91293439 |
| Molecular Formula | C40H56N2O9 |
| Molecular Weight | 708.89 g/mol |
| Exact Mass | 708.40 |
| IUPAC Name | 1-[4-[1-[6-(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoyloxy]ethoxy]butoxy]ethyl 6-(3-methylidene-7-oxo-4-azatricyclo[6.2.1.02,6]undec-8-en-4-yl)hexanoate |
| SMILES | C=C1C2C3CC=C(C3)C(=O)C2CN1CCCCCC(=O)OC(C)OCCCCOC(C)OC(=O)CCCCCn1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C40H56N2O9/c1-25-35-28-16-17-31(23-28)38(45)32(35)24-41(25)18-8-4-6-12-33(43)50-26(2)48-20-10-11-21-49-27(3)51-34(44)13-7-5-9-19-42-39(46)36-29-14-15-30(22-29)37(36)40(42)47/h14-15,17,26-30,32,35,46-47H,1,4-13,16,18-24H2,2-3H3 |
| InChIKey | WDQXOPKPZQQORL-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.89 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|