C16H21NO4 — CID 90818215
6-(3,5-dihydroxy-10-methyl-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoic acid (PubChem CID 90818215) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 6-(3,5-dihydroxy-10-methyl-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoic acid.
| Compound Name | 6-(3,5-dihydroxy-10-methyl-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoic acid |
|---|---|
| PubChem CID | 90818215 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 6-(3,5-dihydroxy-10-methyl-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoic acid |
| SMILES | CC1C2C=CC1c1c2c(O)n(CCCCCC(=O)O)c1O |
| InChI | InChI=1S/C16H21NO4/c1-9-10-6-7-11(9)14-13(10)15(20)17(16(14)21)8-4-2-3-5-12(18)19/h6-7,9-11,20-21H,2-5,8H2,1H3,(H,18,19) |
| InChIKey | XXOVUEKYXFFEBQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|