C24H37NO5 — CID 91495870
1-pentoxyethyl 6-(3,5-dihydroxy-8,10-dimethyl-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoate (PubChem CID 91495870) has the molecular formula C24H37NO5 and a molecular weight of 419.56 g/mol. Its IUPAC name is 1-pentoxyethyl 6-(3,5-dihydroxy-8,10-dimethyl-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoate.
| Compound Name | 1-pentoxyethyl 6-(3,5-dihydroxy-8,10-dimethyl-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoate |
|---|---|
| PubChem CID | 91495870 |
| Molecular Formula | C24H37NO5 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | 1-pentoxyethyl 6-(3,5-dihydroxy-8,10-dimethyl-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)hexanoate |
| SMILES | CCCCCOC(C)OC(=O)CCCCCn1c(O)c2c(c1O)C1C(C)=CC2C1C |
| InChI | InChI=1S/C24H37NO5/c1-5-6-10-13-29-17(4)30-19(26)11-8-7-9-12-25-23(27)21-18-14-15(2)20(16(18)3)22(21)24(25)28/h14,16-18,20,27-28H,5-13H2,1-4H3 |
| InChIKey | YBRAYWHBPQRRGB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|