C23H35N3O4 — CID 57081189
[1-[(7R)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-3-(4-methylpiperazin-1-yl)propan-2-yl] hexanoate (PubChem CID 57081189) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is [1-[(7R)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-3-(4-methylpiperazin-1-yl)propan-2-yl] hexanoate.
| Compound Name | [1-[(7R)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-3-(4-methylpiperazin-1-yl)propan-2-yl] hexanoate |
|---|---|
| PubChem CID | 57081189 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | [1-[(7R)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-3-(4-methylpiperazin-1-yl)propan-2-yl] hexanoate |
| SMILES | CCCCCC(=O)OC(CN1CCN(C)CC1)Cn1c(O)c2c(c1O)[C@H]1C=CC2C1 |
| InChI | InChI=1S/C23H35N3O4/c1-3-4-5-6-19(27)30-18(14-25-11-9-24(2)10-12-25)15-26-22(28)20-16-7-8-17(13-16)21(20)23(26)29/h7-8,16-18,28-29H,3-6,9-15H2,1-2H3/t16-,17?,18?/m0/s1 |
| InChIKey | ORNVHFKWDWGQGG-AOCRQIFASA-N |
| XLogP | 2.78 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|