C16H19NO4 — CID 54315425
2-(3,5-dihydroxy-1-methyl-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)ethyl 2-methylprop-2-enoate (PubChem CID 54315425) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-(3,5-dihydroxy-1-methyl-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(3,5-dihydroxy-1-methyl-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54315425 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-(3,5-dihydroxy-1-methyl-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCn1c(O)c2c(c1O)C1(C)C=CC2C1 |
| InChI | InChI=1S/C16H19NO4/c1-9(2)15(20)21-7-6-17-13(18)11-10-4-5-16(3,8-10)12(11)14(17)19/h4-5,10,18-19H,1,6-8H2,2-3H3 |
| InChIKey | SNUZVZZICXSVJV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|