C10H15F6N — CID 123139858
1-[4,4,4-trifluoro-3-(trifluoromethyl)butyl]piperidine (PubChem CID 123139858) has the molecular formula C10H15F6N and a molecular weight of 263.22 g/mol. Its IUPAC name is 1-[4,4,4-trifluoro-3-(trifluoromethyl)butyl]piperidine.
| Compound Name | 1-[4,4,4-trifluoro-3-(trifluoromethyl)butyl]piperidine |
|---|---|
| PubChem CID | 123139858 |
| Molecular Formula | C10H15F6N |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-[4,4,4-trifluoro-3-(trifluoromethyl)butyl]piperidine |
| SMILES | FC(F)(F)C(CCN1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H15F6N/c11-9(12,13)8(10(14,15)16)4-7-17-5-2-1-3-6-17/h8H,1-7H2 |
| InChIKey | HJVZVVZTWHGZGA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |