About (8-ethyl-3,8-dimethylheptalen-3-yl)methyl-methylidyneazanium
(8-ethyl-3,8-dimethylheptalen-3-yl)methyl-methylidyneazanium (PubChem CID 123141602) has the molecular formula C18H22N+
and a molecular weight of 252.38 g/mol. Its IUPAC name is (8-ethyl-3,8-dimethylheptalen-3-yl)methyl-methylidyneazanium.
Molecular Properties
| Compound Name | (8-ethyl-3,8-dimethylheptalen-3-yl)methyl-methylidyneazanium |
| PubChem CID | 123141602 |
| Molecular Formula | C18H22N+ |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (8-ethyl-3,8-dimethylheptalen-3-yl)methyl-methylidyneazanium |
| SMILES | C#[N+]CC1(C)C=CC2=C(C=CC(C)(CC)C=C2)C=C1 |
| InChI | InChI=1S/C18H22N/c1-5-17(2)10-6-15-8-12-18(3,14-19-4)13-9-16(15)7-11-17/h4,6-13H,5,14H2,1-3H3/q+1 |
| InChIKey | NXXKAXYWLRIPNS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (8-ethyl-3,8-dimethylheptalen-3-yl)methyl-methylidyneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-ethyl-3,8-dimethylheptalen-3-yl)methyl-methylidyneazanium?
The IUPAC name of (8-ethyl-3,8-dimethylheptalen-3-yl)methyl-methylidyneazanium (CID 123141602) is (8-ethyl-3,8-dimethylheptalen-3-yl)methyl-methylidyneazanium.
What is the SMILES notation for (8-ethyl-3,8-dimethylheptalen-3-yl)methyl-methylidyneazanium?
The canonical SMILES for (8-ethyl-3,8-dimethylheptalen-3-yl)methyl-methylidyneazanium is C#[N+]CC1(C)C=CC2=C(C=CC(C)(CC)C=C2)C=C1.
What is the InChIKey of (8-ethyl-3,8-dimethylheptalen-3-yl)methyl-methylidyneazanium?
The InChIKey is NXXKAXYWLRIPNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N/c1-5-17(2)10-6-15-8-12-18(3,14-19-4)13-9-16(15)7-11-17/h4,6-13H,5,14H2,1-3H3/q+1.
What are the key properties of (8-ethyl-3,8-dimethylheptalen-3-yl)methyl-methylidyneazanium?
(8-ethyl-3,8-dimethylheptalen-3-yl)methyl-methylidyneazanium has a molecular weight of 252.38 g/mol, XLogP of 4.92, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (8-ethyl-3,8-dimethylheptalen-3-yl)methyl-methylidyneazanium is sourced from PubChem (CID 123141602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).