C23H27N5O2 — CID 123142080
6-[1-(methoxyamino)ethenyl]-8-(3-methyl-4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one (PubChem CID 123142080) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 6-[1-(methoxyamino)ethenyl]-8-(3-methyl-4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one.
| Compound Name | 6-[1-(methoxyamino)ethenyl]-8-(3-methyl-4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 123142080 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 6-[1-(methoxyamino)ethenyl]-8-(3-methyl-4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
| SMILES | C=C(NOC)c1cc2cc[nH]c(=O)c2c(Nc2ccc(C3CCNCC3)c(C)c2)n1 |
| InChI | InChI=1S/C23H27N5O2/c1-14-12-18(4-5-19(14)16-6-9-24-10-7-16)26-22-21-17(8-11-25-23(21)29)13-20(27-22)15(2)28-30-3/h4-5,8,11-13,16,24,28H,2,6-7,9-10H2,1,3H3,(H,25,29)(H,26,27) |
| InChIKey | SGGAXXBIBZSJHO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|