C12H14O2S — CID 123142155
1-cyclohexa-1,3-dien-1-ylsulfonylcyclohexa-1,3-diene (PubChem CID 123142155) has the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-ylsulfonylcyclohexa-1,3-diene.
| Compound Name | 1-cyclohexa-1,3-dien-1-ylsulfonylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123142155 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-ylsulfonylcyclohexa-1,3-diene |
| SMILES | O=S(=O)(C1=CC=CCC1)C1=CC=CCC1 |
| InChI | InChI=1S/C12H14O2S/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-3,5,7,9H,4,6,8,10H2 |
| InChIKey | MBWIVLRLVCWHTO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |