C12H12F2O2S — CID 143288947
1-fluoro-4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]sulfonylcyclohexa-1,3-diene (PubChem CID 143288947) has the molecular formula C12H12F2O2S and a molecular weight of 258.29 g/mol. Its IUPAC name is 1-fluoro-4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]sulfonylcyclohexa-1,3-diene.
| Compound Name | 1-fluoro-4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]sulfonylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143288947 |
| Molecular Formula | C12H12F2O2S |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 1-fluoro-4-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]sulfonylcyclohexa-1,3-diene |
| SMILES | C=C(F)/C=C\C(=C)S(=O)(=O)C1=CC=C(F)CC1 |
| InChI | InChI=1S/C12H12F2O2S/c1-9(13)3-4-10(2)17(15,16)12-7-5-11(14)6-8-12/h3-5,7H,1-2,6,8H2/b4-3- |
| InChIKey | RBKSSARPNNUWNG-ARJAWSKDSA-N |
| XLogP | 3.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|