C10H20N3S+ — CID 123142808
1-tert-butyl-1-ethyl-6-methylsulfanyl-2H-1,3,5-triazin-1-ium (PubChem CID 123142808) has the molecular formula C10H20N3S+ and a molecular weight of 214.36 g/mol. Its IUPAC name is 1-tert-butyl-1-ethyl-6-methylsulfanyl-2H-1,3,5-triazin-1-ium.
| Compound Name | 1-tert-butyl-1-ethyl-6-methylsulfanyl-2H-1,3,5-triazin-1-ium |
|---|---|
| PubChem CID | 123142808 |
| Molecular Formula | C10H20N3S+ |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1-tert-butyl-1-ethyl-6-methylsulfanyl-2H-1,3,5-triazin-1-ium |
| SMILES | CC[N+]1(C(C)(C)C)CN=CN=C1SC |
| InChI | InChI=1S/C10H20N3S/c1-6-13(10(2,3)4)8-11-7-12-9(13)14-5/h7H,6,8H2,1-5H3/q+1 |
| InChIKey | OECJLDCZNVELHZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|