C9H18N3S+ — CID 67897256
1-ethyl-2-methylsulfanyl-1-propan-2-yl-2H-1,3,5-triazin-1-ium (PubChem CID 67897256) has the molecular formula C9H18N3S+ and a molecular weight of 200.33 g/mol. Its IUPAC name is 1-ethyl-2-methylsulfanyl-1-propan-2-yl-2H-1,3,5-triazin-1-ium.
| Compound Name | 1-ethyl-2-methylsulfanyl-1-propan-2-yl-2H-1,3,5-triazin-1-ium |
|---|---|
| PubChem CID | 67897256 |
| Molecular Formula | C9H18N3S+ |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 1-ethyl-2-methylsulfanyl-1-propan-2-yl-2H-1,3,5-triazin-1-ium |
| SMILES | CC[N+]1(C(C)C)C=NC=NC1SC |
| InChI | InChI=1S/C9H18N3S/c1-5-12(8(2)3)7-10-6-11-9(12)13-4/h6-9H,5H2,1-4H3/q+1 |
| InChIKey | IDXPJIKVFZMXHW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|