C8H15N3S — CID 141278124
4-ethylsulfanyl-1-propan-2-yl-2H-1,3,5-triazine (PubChem CID 141278124) has the molecular formula C8H15N3S and a molecular weight of 185.30 g/mol. Its IUPAC name is 4-ethylsulfanyl-1-propan-2-yl-2H-1,3,5-triazine.
| Compound Name | 4-ethylsulfanyl-1-propan-2-yl-2H-1,3,5-triazine |
|---|---|
| PubChem CID | 141278124 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 4-ethylsulfanyl-1-propan-2-yl-2H-1,3,5-triazine |
| SMILES | CCSC1=NCN(C(C)C)C=N1 |
| InChI | InChI=1S/C8H15N3S/c1-4-12-8-9-5-11(6-10-8)7(2)3/h5,7H,4,6H2,1-3H3 |
| InChIKey | WSJFNDGBHDWRKG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |