About methyl N-butan-2-yl-N-ethyl-N'-methylcarbamimidothioate
methyl N-butan-2-yl-N-ethyl-N'-methylcarbamimidothioate (PubChem CID 123657797) has the molecular formula C9H20N2S
and a molecular weight of 188.34 g/mol. Its IUPAC name is methyl N-butan-2-yl-N-ethyl-N'-methylcarbamimidothioate.
Molecular Properties
| Compound Name | methyl N-butan-2-yl-N-ethyl-N'-methylcarbamimidothioate |
| PubChem CID | 123657797 |
| Molecular Formula | C9H20N2S |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | methyl N-butan-2-yl-N-ethyl-N'-methylcarbamimidothioate |
| SMILES | CCC(C)N(CC)/C(=N/C)SC |
| InChI | InChI=1S/C9H20N2S/c1-6-8(3)11(7-2)9(10-4)12-5/h8H,6-7H2,1-5H3/b10-9- |
| InChIKey | JBGWBCJEBFMKKY-KTKRTIGZSA-N |
| XLogP | 2.46 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-butan-2-yl-N-ethyl-N'-methylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-butan-2-yl-N-ethyl-N'-methylcarbamimidothioate?
The IUPAC name of methyl N-butan-2-yl-N-ethyl-N'-methylcarbamimidothioate (CID 123657797) is methyl N-butan-2-yl-N-ethyl-N'-methylcarbamimidothioate.
What is the SMILES notation for methyl N-butan-2-yl-N-ethyl-N'-methylcarbamimidothioate?
The canonical SMILES for methyl N-butan-2-yl-N-ethyl-N'-methylcarbamimidothioate is CCC(C)N(CC)/C(=N/C)SC.
What is the InChIKey of methyl N-butan-2-yl-N-ethyl-N'-methylcarbamimidothioate?
The InChIKey is JBGWBCJEBFMKKY-KTKRTIGZSA-N. The full InChI is InChI=1S/C9H20N2S/c1-6-8(3)11(7-2)9(10-4)12-5/h8H,6-7H2,1-5H3/b10-9-.
What are the key properties of methyl N-butan-2-yl-N-ethyl-N'-methylcarbamimidothioate?
methyl N-butan-2-yl-N-ethyl-N'-methylcarbamimidothioate has a molecular weight of 188.34 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-butan-2-yl-N-ethyl-N'-methylcarbamimidothioate is sourced from PubChem (CID 123657797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).