C14H22F3NO3 — CID 123144173
tert-butyl 4-hydroxy-4-(4,4,4-trifluorobut-1-enyl)piperidine-1-carboxylate (PubChem CID 123144173) has the molecular formula C14H22F3NO3 and a molecular weight of 309.33 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-(4,4,4-trifluorobut-1-enyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-(4,4,4-trifluorobut-1-enyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123144173 |
| Molecular Formula | C14H22F3NO3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | tert-butyl 4-hydroxy-4-(4,4,4-trifluorobut-1-enyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(C=CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H22F3NO3/c1-12(2,3)21-11(19)18-9-7-13(20,8-10-18)5-4-6-14(15,16)17/h4-5,20H,6-10H2,1-3H3 |
| InChIKey | GCCDLJLQRNOCKG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|