C12H19NO2 — CID 123144510
methyl 3-prop-1-en-2-yl-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 123144510) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is methyl 3-prop-1-en-2-yl-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl 3-prop-1-en-2-yl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 123144510 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | methyl 3-prop-1-en-2-yl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | C=C(C)C1CC2CCC(N2)C1C(=O)OC |
| InChI | InChI=1S/C12H19NO2/c1-7(2)9-6-8-4-5-10(13-8)11(9)12(14)15-3/h8-11,13H,1,4-6H2,2-3H3 |
| InChIKey | UWAVZMDFACBVRG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|