C12H16O2Si — CID 123145677
1-phenyl-1-silylhexane-2,5-dione (PubChem CID 123145677) has the molecular formula C12H16O2Si and a molecular weight of 220.34 g/mol. Its IUPAC name is 1-phenyl-1-silylhexane-2,5-dione.
| Compound Name | 1-phenyl-1-silylhexane-2,5-dione |
|---|---|
| PubChem CID | 123145677 |
| Molecular Formula | C12H16O2Si |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 1-phenyl-1-silylhexane-2,5-dione |
| SMILES | CC(=O)CCC(=O)C([SiH3])c1ccccc1 |
| InChI | InChI=1S/C12H16O2Si/c1-9(13)7-8-11(14)12(15)10-5-3-2-4-6-10/h2-6,12H,7-8H2,1,15H3 |
| InChIKey | ZAAHAQOZDLFRHU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|