About (1-phenylethylamino) 4-oxopentanoate
(1-phenylethylamino) 4-oxopentanoate (PubChem CID 175030931) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is (1-phenylethylamino) 4-oxopentanoate.
Molecular Properties
| Compound Name | (1-phenylethylamino) 4-oxopentanoate |
| PubChem CID | 175030931 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (1-phenylethylamino) 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)ONC(C)c1ccccc1 |
| InChI | InChI=1S/C13H17NO3/c1-10(15)8-9-13(16)17-14-11(2)12-6-4-3-5-7-12/h3-7,11,14H,8-9H2,1-2H3 |
| InChIKey | BJGBJJWCZPRGDR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-phenylethylamino) 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-phenylethylamino) 4-oxopentanoate?
The IUPAC name of (1-phenylethylamino) 4-oxopentanoate (CID 175030931) is (1-phenylethylamino) 4-oxopentanoate.
What is the SMILES notation for (1-phenylethylamino) 4-oxopentanoate?
The canonical SMILES for (1-phenylethylamino) 4-oxopentanoate is CC(=O)CCC(=O)ONC(C)c1ccccc1.
What is the InChIKey of (1-phenylethylamino) 4-oxopentanoate?
The InChIKey is BJGBJJWCZPRGDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-10(15)8-9-13(16)17-14-11(2)12-6-4-3-5-7-12/h3-7,11,14H,8-9H2,1-2H3.
What are the key properties of (1-phenylethylamino) 4-oxopentanoate?
(1-phenylethylamino) 4-oxopentanoate has a molecular weight of 235.28 g/mol, XLogP of 2.16, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-phenylethylamino) 4-oxopentanoate is sourced from PubChem (CID 175030931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).