C16H18N2O2 — CID 23275370
2-phenoxy-N'-(1-phenylethyl)acetohydrazide (PubChem CID 23275370) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-phenoxy-N'-(1-phenylethyl)acetohydrazide.
| Compound Name | 2-phenoxy-N'-(1-phenylethyl)acetohydrazide |
|---|---|
| PubChem CID | 23275370 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-phenoxy-N'-(1-phenylethyl)acetohydrazide |
| SMILES | CC(NNC(=O)COc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O2/c1-13(14-8-4-2-5-9-14)17-18-16(19)12-20-15-10-6-3-7-11-15/h2-11,13,17H,12H2,1H3,(H,18,19) |
| InChIKey | PJSHCNPHOMUVQW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|