C15H24N2 — CID 123145781
N-methyl-6-methylidene-1-penta-2,4-dien-2-yl-N-propyl-2,3-dihydropyridin-5-amine (PubChem CID 123145781) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is N-methyl-6-methylidene-1-penta-2,4-dien-2-yl-N-propyl-2,3-dihydropyridin-5-amine.
| Compound Name | N-methyl-6-methylidene-1-penta-2,4-dien-2-yl-N-propyl-2,3-dihydropyridin-5-amine |
|---|---|
| PubChem CID | 123145781 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | N-methyl-6-methylidene-1-penta-2,4-dien-2-yl-N-propyl-2,3-dihydropyridin-5-amine |
| SMILES | C=CC=C(C)N1CCC=C(N(C)CCC)C1=C |
| InChI | InChI=1S/C15H24N2/c1-6-9-13(3)17-12-8-10-15(14(17)4)16(5)11-7-2/h6,9-10H,1,4,7-8,11-12H2,2-3,5H3 |
| InChIKey | OAATXTHXEQLACR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|