C14H25FN2 — CID 143566790
N-fluoro-N-methyl-N'-[(2E,4Z)-3-methylhepta-2,4,6-trien-2-yl]-N'-propylethane-1,2-diamine (PubChem CID 143566790) has the molecular formula C14H25FN2 and a molecular weight of 240.37 g/mol. Its IUPAC name is N-fluoro-N-methyl-N'-[(2E,4Z)-3-methylhepta-2,4,6-trien-2-yl]-N'-propylethane-1,2-diamine.
| Compound Name | N-fluoro-N-methyl-N'-[(2E,4Z)-3-methylhepta-2,4,6-trien-2-yl]-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 143566790 |
| Molecular Formula | C14H25FN2 |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | N-fluoro-N-methyl-N'-[(2E,4Z)-3-methylhepta-2,4,6-trien-2-yl]-N'-propylethane-1,2-diamine |
| SMILES | C=C/C=C\C(C)=C(/C)N(CCC)CCN(C)F |
| InChI | InChI=1S/C14H25FN2/c1-6-8-9-13(3)14(4)17(10-7-2)12-11-16(5)15/h6,8-9H,1,7,10-12H2,2-5H3/b9-8-,14-13+ |
| InChIKey | QIBRYOPTZYVEMI-NRSBDZSJSA-N |
| XLogP | 3.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|