C13H23FN2 — CID 143566944
N'-ethyl-N'-fluoro-N-[(2E,4Z,6Z)-3-methylocta-2,4,6-trien-2-yl]ethane-1,2-diamine (PubChem CID 143566944) has the molecular formula C13H23FN2 and a molecular weight of 226.34 g/mol. Its IUPAC name is N'-ethyl-N'-fluoro-N-[(2E,4Z,6Z)-3-methylocta-2,4,6-trien-2-yl]ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-fluoro-N-[(2E,4Z,6Z)-3-methylocta-2,4,6-trien-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 143566944 |
| Molecular Formula | C13H23FN2 |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | N'-ethyl-N'-fluoro-N-[(2E,4Z,6Z)-3-methylocta-2,4,6-trien-2-yl]ethane-1,2-diamine |
| SMILES | C/C=C\C=C/C(C)=C(\C)NCCN(F)CC |
| InChI | InChI=1S/C13H23FN2/c1-5-7-8-9-12(3)13(4)15-10-11-16(14)6-2/h5,7-9,15H,6,10-11H2,1-4H3/b7-5-,9-8-,13-12+ |
| InChIKey | IFVFAJJZKRDGDO-KEYUGAMUSA-N |
| XLogP | 3.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|