C15H25F3N2 — CID 143043423
N,N'-diethyl-N'-[(2E,4Z,6E)-6-(trifluoromethyl)octa-2,4,6-trien-3-yl]ethane-1,2-diamine (PubChem CID 143043423) has the molecular formula C15H25F3N2 and a molecular weight of 290.37 g/mol. Its IUPAC name is N,N'-diethyl-N'-[(2E,4Z,6E)-6-(trifluoromethyl)octa-2,4,6-trien-3-yl]ethane-1,2-diamine.
| Compound Name | N,N'-diethyl-N'-[(2E,4Z,6E)-6-(trifluoromethyl)octa-2,4,6-trien-3-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 143043423 |
| Molecular Formula | C15H25F3N2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N,N'-diethyl-N'-[(2E,4Z,6E)-6-(trifluoromethyl)octa-2,4,6-trien-3-yl]ethane-1,2-diamine |
| SMILES | C/C=C(\C=C/C(=C\C)C(F)(F)F)N(CC)CCNCC |
| InChI | InChI=1S/C15H25F3N2/c1-5-13(15(16,17)18)9-10-14(6-2)20(8-4)12-11-19-7-3/h5-6,9-10,19H,7-8,11-12H2,1-4H3/b10-9-,13-5+,14-6+ |
| InChIKey | LSTVSGCWWZGKTI-VWBVVNMPSA-N |
| XLogP | 3.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|