C15H25FN2 — CID 143686557
(2E,4E)-3-ethenyl-1-N-[(E)-2-ethylpent-2-enyl]-4-fluorohexa-2,4-diene-1,2-diamine (PubChem CID 143686557) has the molecular formula C15H25FN2 and a molecular weight of 252.38 g/mol. Its IUPAC name is (2E,4E)-3-ethenyl-1-N-[(E)-2-ethylpent-2-enyl]-4-fluorohexa-2,4-diene-1,2-diamine.
| Compound Name | (2E,4E)-3-ethenyl-1-N-[(E)-2-ethylpent-2-enyl]-4-fluorohexa-2,4-diene-1,2-diamine |
|---|---|
| PubChem CID | 143686557 |
| Molecular Formula | C15H25FN2 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | (2E,4E)-3-ethenyl-1-N-[(E)-2-ethylpent-2-enyl]-4-fluorohexa-2,4-diene-1,2-diamine |
| SMILES | C=CC(/C(F)=C\C)=C(\N)CNC/C(=C/CC)CC |
| InChI | InChI=1S/C15H25FN2/c1-5-9-12(6-2)10-18-11-15(17)13(7-3)14(16)8-4/h7-9,18H,3,5-6,10-11,17H2,1-2,4H3/b12-9+,14-8+,15-13+ |
| InChIKey | DPAITDPORDXKQP-BXNWYQDESA-N |
| XLogP | 3.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|