C14H23FN2 — CID 142350904
1-[(2E,4E,6E)-3-fluoro-5-methylocta-2,4,6-trien-4-yl]-4-methylpiperazine (PubChem CID 142350904) has the molecular formula C14H23FN2 and a molecular weight of 238.35 g/mol. Its IUPAC name is 1-[(2E,4E,6E)-3-fluoro-5-methylocta-2,4,6-trien-4-yl]-4-methylpiperazine.
| Compound Name | 1-[(2E,4E,6E)-3-fluoro-5-methylocta-2,4,6-trien-4-yl]-4-methylpiperazine |
|---|---|
| PubChem CID | 142350904 |
| Molecular Formula | C14H23FN2 |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 1-[(2E,4E,6E)-3-fluoro-5-methylocta-2,4,6-trien-4-yl]-4-methylpiperazine |
| SMILES | C/C=C/C(C)=C(C(\F)=C/C)/N1CCN(C)CC1 |
| InChI | InChI=1S/C14H23FN2/c1-5-7-12(3)14(13(15)6-2)17-10-8-16(4)9-11-17/h5-7H,8-11H2,1-4H3/b7-5+,13-6+,14-12+ |
| InChIKey | CIDTUYWQOGFJGW-USTRSPMQSA-N |
| XLogP | 2.96 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|