C20H23NO3 — CID 123146064
3-(2,5-dihydroxy-4-methyl-3,6-dimethylidenecyclohexa-1,4-dien-1-yl)-3-methyl-N-phenylbutanamide (PubChem CID 123146064) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-(2,5-dihydroxy-4-methyl-3,6-dimethylidenecyclohexa-1,4-dien-1-yl)-3-methyl-N-phenylbutanamide.
| Compound Name | 3-(2,5-dihydroxy-4-methyl-3,6-dimethylidenecyclohexa-1,4-dien-1-yl)-3-methyl-N-phenylbutanamide |
|---|---|
| PubChem CID | 123146064 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 3-(2,5-dihydroxy-4-methyl-3,6-dimethylidenecyclohexa-1,4-dien-1-yl)-3-methyl-N-phenylbutanamide |
| SMILES | C=c1c(C)c(O)c(=C)c(C(C)(C)CC(=O)Nc2ccccc2)c1O |
| InChI | InChI=1S/C20H23NO3/c1-12-13(2)19(24)17(14(3)18(12)23)20(4,5)11-16(22)21-15-9-7-6-8-10-15/h6-10,23-24H,2-3,11H2,1,4-5H3,(H,21,22) |
| InChIKey | BUCILBLOZHRHNQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|